ψ-BBB
2-(2,6-Dibutoxy-4-butylphenyl)ethan-1-amine
 7808 C20H35NO2 321.497
 InChI=1S/C20H35NO2/c1-4-7-10-17-15-19(22-13-8-5-2)18(11-12-21)20(16-17)23-14-9-6-3/h15-16H,4-14,21H2,1-3H3
 WFVLBHJOWVWGHH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCc1cc(OCCCC)c(c(c1)OCCCC)CCN