ψ-2C-T-7
2-[2,6-Dimethoxy-4-(propylsulfanyl)phenyl]ethan-1-amine
 7801 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-7-17-10-8-12(15-2)11(5-6-14)13(9-10)16-3/h8-9H,4-7,14H2,1-3H3
 LUKMDQTYSWLPHD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)c(c(c1)OC)CCN