4,6,2-2C-T-7
2-[2,4-Dimethoxy-6-(propylsulfanyl)phenyl]ethan-1-amine
 7779 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-7-17-13-9-10(15-2)8-12(16-3)11(13)5-6-14/h8-9H,4-7,14H2,1-3H3
 NRSOYRJGOCMPMH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1cc(OC)cc(c1CCN)OC