2,4,6-DOB
1-(2-Bromo-4,6-dimethoxyphenyl)propan-2-amine
 7772 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(13)4-9-10(12)5-8(14-2)6-11(9)15-3/h5-7H,4,13H2,1-3H3
 QEZQLIBEVDLHCE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(Br)c(c(c1)OC)CC(N)C