2,4,6-BMM
2-(2-Bromo-4,6-dimethoxyphenyl)ethan-1-amine
 7771 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-7-5-9(11)8(3-4-12)10(6-7)14-2/h5-6H,3-4,12H2,1-2H3
 JJSRDODDATVPNT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Br)cc(cc1OC)OC