DOTFM-6
1-[2,6-Dimethoxy-4-(trifluoromethyl)phenyl]propan-2-amine
 7766 C12H16F3NO2 263.256
 InChI=1S/C12H16F3NO2/c1-7(16)4-9-10(17-2)5-8(12(13,14)15)6-11(9)18-3/h5-7H,4,16H2,1-3H3
 DZZWUCOCRKSNLR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(cc(c1CC(N)C)OC)C(F)(F)F