2,6-Me-4-EPEA
2-(4-Ethoxy-2,6-dimethylphenyl)ethan-1-amine
 7762 C12H19NO 193.285
 InChI=1S/C12H19NO/c1-4-14-11-7-9(2)12(5-6-13)10(3)8-11/h7-8H,4-6,13H2,1-3H3
 PMVDYDANJXNRDR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)cc(cc1C)OCC