2,6-Me-MPEA
2-(4-Methoxy-2,6-dimethylphenyl)ethan-1-amine
 7759 C11H17NO 179.259
 InChI=1S/C11H17NO/c1-8-6-10(13-3)7-9(2)11(8)4-5-12/h6-7H,4-5,12H2,1-3H3
 QNQGECDYQYVFRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)cc(cc1C)OC