TMeA-6
1-(2,4,6-Trimethylphenyl)propan-2-amine
 7758 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-5-9(2)12(7-11(4)13)10(3)6-8/h5-6,11H,7,13H2,1-4H3
 ZYOFNLDUJMKHAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(C)cc(cc1C)C)N