2,3,6-DOB
1-(2-Bromo-3,6-dimethoxyphenyl)propan-2-amine
 7730 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(13)6-8-9(14-2)4-5-10(15-3)11(8)12/h4-5,7H,6,13H2,1-3H3
 NJFHFMVZHWXSEF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c(c1Br)CC(N)C)OC