2,3,6-BMM
2-(2-Bromo-3,6-dimethoxyphenyl)ethan-1-amine
 7729 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-8-3-4-9(14-2)10(11)7(8)5-6-12/h3-4H,5-6,12H2,1-2H3
 NPODAKNROTULMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)ccc(c1Br)OC