2,6,3-2C-T-7
2-[2,6-Dimethoxy-3-(propylsulfanyl)phenyl]ethan-1-amine
 7728 C13H21NO2S 255.376
 InChI=1S/C13H21NO2S/c1-4-9-17-12-6-5-11(15-2)10(7-8-14)13(12)16-3/h5-6H,4,7-9,14H2,1-3H3
 LSQXLBQXTIYXKL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCSc1ccc(c(c1OC)CCN)OC