3,2,6-DOET
1-(3-Ethyl-2,6-dimethoxyphenyl)propan-2-amine
 7727 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-10-6-7-12(15-3)11(8-9(2)14)13(10)16-4/h6-7,9H,5,8,14H2,1-4H3
 ONLACZIPGGBGSM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(CC)ccc(c1CC(N)C)OC