2,3,6-MBM
2-(3-Bromo-2,6-dimethoxyphenyl)ethan-1-amine
 7721 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-9-4-3-8(11)10(14-2)7(9)5-6-12/h3-4H,5-6,12H2,1-2H3
 MMVHXQLRQPGAFQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(OC)ccc(c1OC)Br