6-Me-2,3-DOM
1-(2,3-Dimethoxy-6-methylphenyl)propan-2-amine
 7719 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-8-5-6-11(14-3)12(15-4)10(8)7-9(2)13/h5-6,9H,7,13H2,1-4H3
 MWSXLWTUCVALNM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(OC)ccc(c1CC(N)C)C