TMeA-5
1-(2,3,6-Trimethylphenyl)propan-2-amine
 7718 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-5-6-9(2)12(11(8)4)7-10(3)13/h5-6,10H,7,13H2,1-4H3
 MHXHNRJSRJTVMS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(C)ccc(c1C)C)N