2,3,6-MMB
2-(6-Bromo-2,3-dimethoxyphenyl)ethan-1-amine
 7715 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-9-4-3-8(11)7(5-6-12)10(9)14-2/h3-4H,5-6,12H2,1-2H3
 GMHBLEWWWICOJF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Br)ccc(c1OC)OC