2-(tert-Butylamino)-1-(3-methylphenyl)propan-1-one
 768 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-10-7-6-8-12(9-10)13(16)11(2)15-14(3,4)5/h6-9,11,15H,1-5H3
 YDGOUEKZXBLUDG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Cc1cccc(c1)C(=O)C(NC(C)(C)C)C