4-HO-EALT
3-{2-[Ethyl(prop-2-en-1-yl)amino]ethyl}-1H-indol-4-ol
 7596  C15H20N2O  244.332
 Prophetic?
 InChI=1S/C15H20N2O/c1-3-9-17(4-2)10-8-12-11-16-13-6-5-7-14(18)15(12)13/h3,5-7,11,16,18H,1,4,8-10H2,2H3
 NOYGBPMOTDWKIU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCN(CCc1c[nH]c2c1c(O)ccc2)CC