4-HO-MCPMT
3-{2-[(Cyclopropylmethyl)(methyl)amino]ethyl}-1H-indol-4-ol
 7595  C15H20N2O  244.332
 Prophetic?
 InChI=1S/C15H20N2O/c1-17(10-11-5-6-11)8-7-12-9-16-13-3-2-4-14(18)15(12)13/h2-4,9,11,16,18H,5-8,10H2,1H3
 DIJSLGHGOZEXCV-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CC1CC1)CCc1c[nH]c2c1c(O)ccc2