4-HO-ECPT
3-{2-[Cyclopropyl(ethyl)amino]ethyl}-1H-indol-4-ol
 7594  C15H20N2O  244.332
 Prophetic?
 InChI=1S/C15H20N2O/c1-2-17(12-6-7-12)9-8-11-10-16-13-4-3-5-14(18)15(11)13/h3-5,10,12,16,18H,2,6-9H2,1H3
 OVPMYVHJEJNSGA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(C1CC1)CCc1c[nH]c2c1c(O)ccc2