4-HO-PIPT
3-{2-[(Propan-2-yl)(propyl)amino]ethyl}-1H-indol-4-ol
 7589  C16H24N2O  260.375
 Prophetic?
 InChI=1S/C16H24N2O/c1-4-9-18(12(2)3)10-8-13-11-17-14-6-5-7-15(19)16(13)14/h5-7,11-12,17,19H,4,8-10H2,1-3H3
 CUTUPKOZXNFVHK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C(C)C)CCc1c[nH]c2c1c(O)ccc2