4-HO-MCBT
3-{2-[Cyclobutyl(methyl)amino]ethyl}-1H-indol-4-ol
 7587  C15H20N2O  244.332
 Prophetic?
 InChI=1S/C15H20N2O/c1-17(12-4-2-5-12)9-8-11-10-16-13-6-3-7-14(18)15(11)13/h3,6-7,10,12,16,18H,2,4-5,8-9H2,1H3
 NGLHUXXEQJYHDF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(C1CCC1)CCc1c[nH]c2c1c(O)ccc2