4-HO-IPSBT
3-{2-[(Butan-2-yl)(propan-2-yl)amino]ethyl}-1H-indol-4-ol
 7585  C17H26N2O  274.401
 Prophetic?
 InChI=1S/C17H26N2O/c1-5-13(4)19(12(2)3)10-9-14-11-18-15-7-6-8-16(20)17(14)15/h6-8,11-13,18,20H,5,9-10H2,1-4H3
 GXPYUPZCTXRCNH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(N(C(C)C)CCc1c[nH]c2c1c(O)ccc2)C