4-HO-NSBT
3-{2-[(Butan-2-yl)amino]ethyl}-1H-indol-4-ol
 7580 C14H20N2O 232.321
 Prophetic?
 InChI=1S/C14H20N2O/c1-3-10(2)15-8-7-11-9-16-12-5-4-6-13(17)14(11)12/h4-6,9-10,15-17H,3,7-8H2,1-2H3
 IMUQFYCWUOVAOD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(NCCc1c[nH]c2c1c(O)ccc2)C