4-HO-NALT
3-{2-[(Prop-2-en-1-yl)amino]ethyl}-1H-indol-4-ol
 7579  C13H16N2O  216.279
 Prophetic?
 InChI=1S/C13H16N2O/c1-2-7-14-8-6-10-9-15-11-4-3-5-12(16)13(10)11/h2-5,9,14-16H,1,6-8H2
 QOFKSOQRTVFMAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCNCCc1c[nH]c2c1c(O)ccc2