4-HO-NIPT
3-{2-[(Propan-2-yl)amino]ethyl}-1H-indol-4-ol
 7578  C13H18N2O  218.295
 Prophetic?
 InChI=1S/C13H18N2O/c1-9(2)14-7-6-10-8-15-11-4-3-5-12(16)13(10)11/h3-5,8-9,14-16H,6-7H2,1-2H3
 YJBOZZRZZJEXDB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(NCCc1c[nH]c2c1c(O)ccc2)C