4-HO-β-MT
3-(1-Aminopropan-2-yl)-1H-indol-4-ol
 7577  C11H14N2O  190.242
 Prophetic?
 InChI=1S/C11H14N2O/c1-7(5-12)8-6-13-9-3-2-4-10(14)11(8)9/h2-4,6-7,13-14H,5,12H2,1H3
 KZFZLEKQBOIRQC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1c[nH]c2c1c(O)ccc2)C