4-HO-α-ET
3-(2-Aminobutyl)-1H-indol-4-ol
 7576  C12H16N2O  204.268
 InChI=1S/C12H16N2O/c1-2-9(13)6-8-7-14-10-4-3-5-11(15)12(8)10/h3-5,7,9,14-15H,2,6,13H2,1H3
 GIJVUFHSPGKRKQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1c[nH]c2c1c(O)ccc2)N