3,4,5-DOB
1-(3-Bromo-4,5-dimethoxyphenyl)propan-2-amine
 7574 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-7(13)4-8-5-9(12)11(15-3)10(6-8)14-2/h5-7H,4,13H2,1-3H3
 ZCCTYRNKQKAYJU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1OC)Br