3,4,5-BMM
2-(3-Bromo-4,5-dimethoxyphenyl)ethan-1-amine
 7573 C10H14BrNO2 260.128
 InChI=1S/C10H14BrNO2/c1-13-9-6-7(3-4-12)5-8(11)10(9)14-2/h5-6H,3-4,12H2,1-2H3
 IDCGMROWYPOYMN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)Br)OC