DESMETHYL-MM
4-[2-(Dimethylamino)ethyl]-2,6-dimethoxyphenol
 7569 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-13(2)6-5-9-7-10(15-3)12(14)11(8-9)16-4/h7-8,14H,5-6H2,1-4H3
 KCJSOMKZGOMQCA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CCN(C)C)cc(c1O)OC