4,3,5-DOET
1-(4-Ethyl-3,5-dimethoxyphenyl)propan-2-amine
 7565 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11-12(15-3)7-10(6-9(2)14)8-13(11)16-4/h7-9H,5-6,14H2,1-4H3
 KEGYUIJAEJAVAM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1CC)OC