4-Me-3,5-DOM
1-(3,5-Dimethoxy-4-methylphenyl)propan-2-amine
 7564 C12H19NO2 209.285
 InChI=1S/C12H19NO2/c1-8(13)5-10-6-11(14-3)9(2)12(7-10)15-4/h6-8H,5,13H2,1-4H3
 LBPKSLBJENJHCH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1C)OC