3,5-IDNNA-4
1-(4-Iodo-3,5-dimethoxyphenyl)-N,N-dimethylpropan-2-amine
 7562 C13H20INO2 349.208
 InChI=1S/C13H20INO2/c1-9(15(2)3)6-10-7-11(16-4)13(14)12(8-10)17-5/h7-9H,6H2,1-5H3
 UJQWJIPPWWKPFI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N(C)C)C)cc(c1I)OC