BEDA
1-(8-Bromo-2,3-dihydro-1,4-benzodioxin-6-yl)propan-2-amine
 7518  C11H14BrNO2  272.138
 InChI=1S/C11H14BrNO2/c1-7(13)4-8-5-9(12)11-10(6-8)14-2-3-15-11/h5-7H,2-4,13H2,1H3
 LANJIDXWXJMTRY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc2OCCOc2c(c1)Br)N