3,5-Br-4-MPEA
2-(3,5-Dibromo-4-methoxyphenyl)ethan-1-amine
 7517  C9H11Br2NO  308.998
 InChI=1S/C9H11Br2NO/c1-13-9-7(10)4-6(2-3-12)5-8(9)11/h4-5H,2-3,12H2,1H3
 LFYPXTIJRXGXFZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(Br)c(c(c1)Br)OC