3,5-Cl-4-BPEA
2-(4-Butoxy-3,5-dichlorophenyl)ethan-1-amine
 7511  C12H17Cl2NO  262.175
 InChI=1S/C12H17Cl2NO/c1-2-3-6-16-12-10(13)7-9(4-5-15)8-11(12)14/h7-8H,2-6,15H2,1H3
 XKLASDBBEZZNCJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCOc1c(Cl)cc(cc1Cl)CCN