3,5-Cl-4-PPEA
2-(3,5-Dichloro-4-propoxyphenyl)ethan-1-amine
 7509  C11H15Cl2NO  248.149
 InChI=1S/C11H15Cl2NO/c1-2-5-15-11-9(12)6-8(3-4-14)7-10(11)13/h6-7H,2-5,14H2,1H3
 JYBIZWHMEXXBDM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1c(Cl)cc(cc1Cl)CCN