BIS-TOET
1-[4-Ethyl-2,5-bis(methylsulfanyl)phenyl]propan-2-amine
 7502  C13H21NS2  255.443
 InChI=1S/C13H21NS2/c1-5-10-7-13(16-4)11(6-9(2)14)8-12(10)15-3/h7-9H,5-6,14H2,1-4H3
 OHITVLDPZSBVAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CSc1cc(CC)c(cc1CC(N)C)SC