2-Cyclopentyl-1-phenyl-2-(pyrrolidin-1-yl)ethan-1-one
 7494  C17H23NO  257.371
 InChI=1S/C17H23NO/c19-17(15-10-2-1-3-11-15)16(14-8-4-5-9-14)18-12-6-7-13-18/h1-3,10-11,14,16H,4-9,12-13H2
 JCEGXCDLEDJXIU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(C(N1CCCC1)C1CCCC1)c1ccccc1