(4aS,8aS)-4a-(3-Hydroxyphenyl)-2-methyloctahydroisoquinolin-8a(1H)-ol
 7491 C16H23NO2 261.359
 Prophetic?
 InChI=1S/C16H23NO2/c1-17-10-9-15(13-5-4-6-14(18)11-13)7-2-3-8-16(15,19)12-17/h4-6,11,18-19H,2-3,7-10,12H2,1H3/t15-,16+/m0/s1
 DAHRNDIJXFKFHP-JKSUJKDBSA-N This stereoisomer Any stereoisomer
 CN1CC[C@]2([C@@](C1)(O)CCCC2)c1cccc(c1)O