2-[1-Hydroxy-2-(methylamino)propyl]phenol
 748 C10H15NO2 181.232
 InChI=1S/C10H15NO2/c1-7(11-2)10(13)8-5-3-4-6-9(8)12/h3-7,10-13H,1-2H3
 CFEPSQISKFBCRD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(C(c1ccccc1O)O)C