(2E)-N-Methyl-1-phenylpropan-2-imine
 7474 C10H13N 147.217
 InChI=1S/C10H13N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3/b11-9+
 QZNVOMIMBSGDKS-PKNBQFBNSA-N This stereoisomer Any stereoisomer
 C/N=C(/Cc1ccccc1)\C