5-iPrO-DOM
1-{2-Methoxy-4-methyl-5-[(propan-2-yl)oxy]phenyl}propan-2-amine
 7473 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-9(2)17-13-8-12(7-11(4)15)14(16-5)6-10(13)3/h6,8-9,11H,7,15H2,1-5H3
 KCGRZERRWPBQJU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C)c(cc1CC(N)C)OC(C)C