1-Ethyltryptamine
2-(1-Ethyl-1H-indol-3-yl)ethan-1-amine
 7469 C12H16N2 188.269
 InChI=1S/C12H16N2/c1-2-14-9-10(7-8-13)11-5-3-4-6-12(11)14/h3-6,9H,2,7-8,13H2,1H3
 DAHZNRLDSGNWPR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cn(c2c1cccc2)CC