Ethyl heptedrone
2-(Ethylamino)-1-phenylheptan-1-one
 7451 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-3-5-7-12-14(16-4-2)15(17)13-10-8-6-9-11-13/h6,8-11,14,16H,3-5,7,12H2,1-2H3
 KCDBNUUMBCYCQC-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCC(C(=O)c1ccccc1)NCC