DOM-2,5-DIEtO
1-(2,5-Diethoxy-4-methylphenyl)propan-2-amine
 7424 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-16-13-9-12(8-11(4)15)14(17-6-2)7-10(13)3/h7,9,11H,5-6,8,15H2,1-4H3
 IFOVMAYZCWAFKA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC(N)C)c(cc1C)OCC