2C-B-5-EtO
2-(4-Bromo-5-ethoxy-2-methoxyphenyl)ethan-1-amine
 7420 C11H16BrNO2 274.154
 InChI=1S/C11H16BrNO2/c1-3-15-11-6-8(4-5-13)10(14-2)7-9(11)12/h6-7H,3-5,13H2,1-2H3
 OOAVAHXKEKAQFF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OCC)c(cc1OC)Br