Heliamine
6,7-Dimethoxy-1,2,3,4-tetrahydroisoquinoline
 740 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h5-6,12H,3-4,7H2,1-2H3
 CEIXWJHURKEBMQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc2CNCCc2cc1OC